C12H20N4S — CID 81198734
methyl N-cyano-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidothioate (PubChem CID 81198734) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is methyl N-cyano-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidothioate.
| Compound Name | methyl N-cyano-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidothioate |
|---|---|
| PubChem CID | 81198734 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl N-cyano-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidothioate |
| SMILES | CS/C(=N\C#N)N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C12H20N4S/c1-15-6-3-4-10-8-16(7-5-11(10)15)12(17-2)14-9-13/h10-11H,3-8H2,1-2H3/b14-12- |
| InChIKey | PYIREZOQKNEHEM-OWBHPGMISA-N |
| XLogP | 1.60 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|