C9H22N4 — CID 91169471
1,4,7-trimethyl-1,4,7-triazonan-2-amine (PubChem CID 91169471) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,4,7-trimethyl-1,4,7-triazonan-2-amine.
| Compound Name | 1,4,7-trimethyl-1,4,7-triazonan-2-amine |
|---|---|
| PubChem CID | 91169471 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 1,4,7-trimethyl-1,4,7-triazonan-2-amine |
| SMILES | CN1CCN(C)CC(N)N(C)CC1 |
| InChI | InChI=1S/C9H22N4/c1-11-4-5-12(2)8-9(10)13(3)7-6-11/h9H,4-8,10H2,1-3H3 |
| InChIKey | LQJCEKNFJMHZSB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |