C12H26N4 — CID 63896354
1-[(1,4-dimethylpiperazin-2-yl)methyl]piperidin-4-amine (PubChem CID 63896354) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]piperidin-4-amine.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 63896354 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]piperidin-4-amine |
| SMILES | CN1CCN(C)C(CN2CCC(N)CC2)C1 |
| InChI | InChI=1S/C12H26N4/c1-14-7-8-15(2)12(9-14)10-16-5-3-11(13)4-6-16/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | KCZKLJJUYUUBGJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |