C8H17ClN2 — CID 178030673
2-(2-chloroethyl)-1,4-dimethylpiperazine (PubChem CID 178030673) has the molecular formula C8H17ClN2 and a molecular weight of 176.69 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1,4-dimethylpiperazine.
| Compound Name | 2-(2-chloroethyl)-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 178030673 |
| Molecular Formula | C8H17ClN2 |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-(2-chloroethyl)-1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)C(CCCl)C1 |
| InChI | InChI=1S/C8H17ClN2/c1-10-5-6-11(2)8(7-10)3-4-9/h8H,3-7H2,1-2H3 |
| InChIKey | DGHMTVNNCRGLII-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|