C11H19ClN4 — CID 115415877
2-[[5-(chloromethyl)-1H-imidazol-2-yl]methyl]-1,4-dimethylpiperazine (PubChem CID 115415877) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1H-imidazol-2-yl]methyl]-1,4-dimethylpiperazine.
| Compound Name | 2-[[5-(chloromethyl)-1H-imidazol-2-yl]methyl]-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 115415877 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-[[5-(chloromethyl)-1H-imidazol-2-yl]methyl]-1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)C(Cc2ncc(CCl)[nH]2)C1 |
| InChI | InChI=1S/C11H19ClN4/c1-15-3-4-16(2)10(8-15)5-11-13-7-9(6-12)14-11/h7,10H,3-6,8H2,1-2H3,(H,13,14) |
| InChIKey | SRCYNBXGIWASJP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|