C11H17ClN4 — CID 115414497
4-chloro-2-[(1,4-dimethylpiperazin-2-yl)methyl]pyrimidine (PubChem CID 115414497) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 4-chloro-2-[(1,4-dimethylpiperazin-2-yl)methyl]pyrimidine.
| Compound Name | 4-chloro-2-[(1,4-dimethylpiperazin-2-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 115414497 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-chloro-2-[(1,4-dimethylpiperazin-2-yl)methyl]pyrimidine |
| SMILES | CN1CCN(C)C(Cc2nccc(Cl)n2)C1 |
| InChI | InChI=1S/C11H17ClN4/c1-15-5-6-16(2)9(8-15)7-11-13-4-3-10(12)14-11/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | ZLPIXPVPABIMEW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |