C13H21BrN4OS — CID 106480675
5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480675) has the molecular formula C13H21BrN4OS and a molecular weight of 361.31 g/mol. Its IUPAC name is 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480675 |
| Molecular Formula | C13H21BrN4OS |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(CC2CN(C)CCN2C)nc(=S)c1Br |
| InChI | InChI=1S/C13H21BrN4OS/c1-17-4-5-18(2)9(7-17)6-11-15-10(8-19-3)12(14)13(20)16-11/h9H,4-8H2,1-3H3,(H,15,16,20) |
| InChIKey | LMXFILRGKIUIKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|