C20H25NO4S — CID 91403608
benzyl 4-methylbenzenesulfonate;(1S,6R)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane (PubChem CID 91403608) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is benzyl 4-methylbenzenesulfonate;(1S,6R)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane.
| Compound Name | benzyl 4-methylbenzenesulfonate;(1S,6R)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 91403608 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | benzyl 4-methylbenzenesulfonate;(1S,6R)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane |
| SMILES | CN1CC[C@H]2O[C@H]2C1.Cc1ccc(S(=O)(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O3S.C6H11NO/c1-12-7-9-14(10-8-12)18(15,16)17-11-13-5-3-2-4-6-13;1-7-3-2-5-6(4-7)8-5/h2-10H,11H2,1H3;5-6H,2-4H2,1H3/t;5-,6+/m.1/s1 |
| InChIKey | UHBAQTOGZXWLIP-BCBTXJGPSA-N |
| XLogP | 2.99 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|