C11H18INO2 — CID 20612036
12-iodo-9,11-dimethyl-7,10-dioxa-2-azatricyclo[6.4.0.02,6]dodecane (PubChem CID 20612036) has the molecular formula C11H18INO2 and a molecular weight of 323.17 g/mol. Its IUPAC name is 12-iodo-9,11-dimethyl-7,10-dioxa-2-azatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 12-iodo-9,11-dimethyl-7,10-dioxa-2-azatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 20612036 |
| Molecular Formula | C11H18INO2 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 12-iodo-9,11-dimethyl-7,10-dioxa-2-azatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1OC(C)C2OC3CCCN3C2C1I |
| InChI | InChI=1S/C11H18INO2/c1-6-9(12)10-11(7(2)14-6)15-8-4-3-5-13(8)10/h6-11H,3-5H2,1-2H3 |
| InChIKey | UWWXQKBGKWJRFS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|