C7H14O2 — CID 171816838
[(2S,3S,5R)-2,5-dimethyloxolan-3-yl]methanol (PubChem CID 171816838) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is [(2S,3S,5R)-2,5-dimethyloxolan-3-yl]methanol.
| Compound Name | [(2S,3S,5R)-2,5-dimethyloxolan-3-yl]methanol |
|---|---|
| PubChem CID | 171816838 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(2S,3S,5R)-2,5-dimethyloxolan-3-yl]methanol |
| SMILES | C[C@@H]1C[C@@H](CO)[C@H](C)O1 |
| InChI | InChI=1S/C7H14O2/c1-5-3-7(4-8)6(2)9-5/h5-8H,3-4H2,1-2H3/t5-,6+,7+/m1/s1 |
| InChIKey | YVZAFNZQJIPGHR-VQVTYTSYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |