C8H14O — CID 145014882
(5S,6R)-6-methyl-8-oxabicyclo[3.2.1]octane (PubChem CID 145014882) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (5S,6R)-6-methyl-8-oxabicyclo[3.2.1]octane.
| Compound Name | (5S,6R)-6-methyl-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 145014882 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (5S,6R)-6-methyl-8-oxabicyclo[3.2.1]octane |
| SMILES | C[C@@H]1CC2CCC[C@@H]1O2 |
| InChI | InChI=1S/C8H14O/c1-6-5-7-3-2-4-8(6)9-7/h6-8H,2-5H2,1H3/t6-,7?,8+/m1/s1 |
| InChIKey | HHSYFAZYLAUWAP-QUFPSDLASA-N |
| XLogP | 1.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |