C8H12O2 — CID 12591241
2,6-dioxatricyclo[3.3.2.03,7]decane (PubChem CID 12591241) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 2,6-dioxatricyclo[3.3.2.03,7]decane.
| Compound Name | 2,6-dioxatricyclo[3.3.2.03,7]decane |
|---|---|
| PubChem CID | 12591241 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2,6-dioxatricyclo[3.3.2.03,7]decane |
| SMILES | C1CC2CC3OC1CC3O2 |
| InChI | InChI=1S/C8H12O2/c1-2-6-4-8-7(10-6)3-5(1)9-8/h5-8H,1-4H2 |
| InChIKey | INHKATMTFKTMPN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |