About 9,10-dioxatricyclo[4.3.1.03,8]decane
9,10-dioxatricyclo[4.3.1.03,8]decane (PubChem CID 54547886) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 9,10-dioxatricyclo[4.3.1.03,8]decane.
Molecular Properties
| Compound Name | 9,10-dioxatricyclo[4.3.1.03,8]decane |
| PubChem CID | 54547886 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 9,10-dioxatricyclo[4.3.1.03,8]decane |
| SMILES | C1CC2CC3OC1CC2O3 |
| InChI | InChI=1S/C8H12O2/c1-2-6-4-7-5(1)3-8(9-6)10-7/h5-8H,1-4H2 |
| InChIKey | ZHVJJXJRGRZNNW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-dioxatricyclo[4.3.1.03,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dioxatricyclo[4.3.1.03,8]decane?
The IUPAC name of 9,10-dioxatricyclo[4.3.1.03,8]decane (CID 54547886) is 9,10-dioxatricyclo[4.3.1.03,8]decane.
What is the SMILES notation for 9,10-dioxatricyclo[4.3.1.03,8]decane?
The canonical SMILES for 9,10-dioxatricyclo[4.3.1.03,8]decane is C1CC2CC3OC1CC2O3.
What is the InChIKey of 9,10-dioxatricyclo[4.3.1.03,8]decane?
The InChIKey is ZHVJJXJRGRZNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-2-6-4-7-5(1)3-8(9-6)10-7/h5-8H,1-4H2.
What are the key properties of 9,10-dioxatricyclo[4.3.1.03,8]decane?
9,10-dioxatricyclo[4.3.1.03,8]decane has a molecular weight of 140.18 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dioxatricyclo[4.3.1.03,8]decane is sourced from PubChem (CID 54547886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).