C12H17BrO3 — CID 101239536
(1S,2S,4R,5S,7R,9S,11R)-4-bromo-8,14,15-trioxatetracyclo[9.2.1.12,5.07,9]pentadecane (PubChem CID 101239536) has the molecular formula C12H17BrO3 and a molecular weight of 289.17 g/mol. Its IUPAC name is (1S,2S,4R,5S,7R,9S,11R)-4-bromo-8,14,15-trioxatetracyclo[9.2.1.12,5.07,9]pentadecane.
| Compound Name | (1S,2S,4R,5S,7R,9S,11R)-4-bromo-8,14,15-trioxatetracyclo[9.2.1.12,5.07,9]pentadecane |
|---|---|
| PubChem CID | 101239536 |
| Molecular Formula | C12H17BrO3 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (1S,2S,4R,5S,7R,9S,11R)-4-bromo-8,14,15-trioxatetracyclo[9.2.1.12,5.07,9]pentadecane |
| SMILES | Br[C@@H]1C[C@@H]2O[C@H]1C[C@H]1O[C@H]1C[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C12H17BrO3/c13-7-4-11-8-2-1-6(14-8)3-10-12(16-10)5-9(7)15-11/h6-12H,1-5H2/t6-,7-,8+,9+,10+,11+,12-/m1/s1 |
| InChIKey | KOEHZJXSLOSVBB-SIIHOQGCSA-N |
| XLogP | 2.02 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|