C7H11NO3 — CID 67016834
7-oxabicyclo[2.2.1]heptan-2-ylcarbamic acid (PubChem CID 67016834) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]heptan-2-ylcarbamic acid.
| Compound Name | 7-oxabicyclo[2.2.1]heptan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 67016834 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 7-oxabicyclo[2.2.1]heptan-2-ylcarbamic acid |
| SMILES | O=C(O)NC1CC2CCC1O2 |
| InChI | InChI=1S/C7H11NO3/c9-7(10)8-5-3-4-1-2-6(5)11-4/h4-6,8H,1-3H2,(H,9,10) |
| InChIKey | XWMONWRTXXRSAT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |