C11H19ClN2O2 — CID 119327690
N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119327690) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119327690 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-(7-oxabicyclo[2.2.1]heptan-2-yl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CC2CCC1O2)C1CCCN1 |
| InChI | InChI=1S/C11H18N2O2.ClH/c14-11(8-2-1-5-12-8)13-9-6-7-3-4-10(9)15-7;/h7-10,12H,1-6H2,(H,13,14);1H |
| InChIKey | PRRHTEFUVPYMJL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |