C11H21ClN2O2 — CID 110911866
N-(2-hydroxycyclohexyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 110911866) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(2-hydroxycyclohexyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 110911866 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(2-hydroxycyclohexyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCCC1O)C1CCCN1 |
| InChI | InChI=1S/C11H20N2O2.ClH/c14-10-6-2-1-4-8(10)13-11(15)9-5-3-7-12-9;/h8-10,12,14H,1-7H2,(H,13,15);1H |
| InChIKey | AKAUBIONUBNCSQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |