C11H20N2O3 — CID 107222110
N-[(1R,2R)-2-hydroxycyclohexyl]morpholine-3-carboxamide (PubChem CID 107222110) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]morpholine-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 107222110 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]morpholine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)C1COCCN1 |
| InChI | InChI=1S/C11H20N2O3/c14-10-4-2-1-3-8(10)13-11(15)9-7-16-6-5-12-9/h8-10,12,14H,1-7H2,(H,13,15)/t8-,9?,10-/m1/s1 |
| InChIKey | KJZSWSNWTUSFHE-RCAUJQPQSA-N |
| XLogP | -0.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |