C8H13IO — CID 94036968
(1R,2R,6R)-2-iodo-9-oxabicyclo[4.2.1]nonane (PubChem CID 94036968) has the molecular formula C8H13IO and a molecular weight of 252.09 g/mol. Its IUPAC name is (1R,2R,6R)-2-iodo-9-oxabicyclo[4.2.1]nonane.
| Compound Name | (1R,2R,6R)-2-iodo-9-oxabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 94036968 |
| Molecular Formula | C8H13IO |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | (1R,2R,6R)-2-iodo-9-oxabicyclo[4.2.1]nonane |
| SMILES | I[C@@H]1CCC[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C8H13IO/c9-7-3-1-2-6-4-5-8(7)10-6/h6-8H,1-5H2/t6-,7-,8-/m1/s1 |
| InChIKey | ZVJZYCQQROXHBI-BWZBUEFSSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|