C12H9F15 — CID 172565321
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylcyclobutane (PubChem CID 172565321) has the molecular formula C12H9F15 and a molecular weight of 438.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylcyclobutane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylcyclobutane |
|---|---|
| PubChem CID | 172565321 |
| Molecular Formula | C12H9F15 |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylcyclobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1CCC1 |
| InChI | InChI=1S/C12H9F15/c13-6(14,4-5-2-1-3-5)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h5H,1-4H2 |
| InChIKey | ZFWLHVKRFZZTEJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|