About 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane
1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane (PubChem CID 171776185) has the molecular formula C5H4F8O
and a molecular weight of 232.07 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane.
Analyze 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane?
The IUPAC name of 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane (CID 171776185) is 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane.
What is the SMILES notation for 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane?
The canonical SMILES for 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane is FC(F)C(F)C(F)(F)OCC(F)(F)F.
What is the InChIKey of 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane?
The InChIKey is MYJMNRLOLXYWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F8O/c6-2(3(7)8)5(12,13)14-1-4(9,10)11/h2-3H,1H2.
What are the key properties of 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane?
1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane has a molecular weight of 232.07 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane is sourced from PubChem (CID 171776185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).