C7H5F11O — CID 11623808
1,1,1,3,3-pentafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane (PubChem CID 11623808) has the molecular formula C7H5F11O and a molecular weight of 314.09 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane.
| Compound Name | 1,1,1,3,3-pentafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane |
|---|---|
| PubChem CID | 11623808 |
| Molecular Formula | C7H5F11O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H5F11O/c8-3(6(14,15)16)7(17,18)19-2-4(9,10)1-5(11,12)13/h3H,1-2H2 |
| InChIKey | PZYDNKBYYBYRCP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |