C5H4Cl2F6O2 — CID 14203788
2-[dichloro(2,2,2-trifluoroethoxy)methoxy]-1,1,1-trifluoroethane (PubChem CID 14203788) has the molecular formula C5H4Cl2F6O2 and a molecular weight of 280.98 g/mol. Its IUPAC name is 2-[dichloro(2,2,2-trifluoroethoxy)methoxy]-1,1,1-trifluoroethane.
| Compound Name | 2-[dichloro(2,2,2-trifluoroethoxy)methoxy]-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 14203788 |
| Molecular Formula | C5H4Cl2F6O2 |
| Molecular Weight | 280.98 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 2-[dichloro(2,2,2-trifluoroethoxy)methoxy]-1,1,1-trifluoroethane |
| SMILES | FC(F)(F)COC(Cl)(Cl)OCC(F)(F)F |
| InChI | InChI=1S/C5H4Cl2F6O2/c6-5(7,14-1-3(8,9)10)15-2-4(11,12)13/h1-2H2 |
| InChIKey | QOTRYQYRSSAOJF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|