C9H4F16O2 — CID 10072322
1,1,1,2,2,4,4,5,5,5-decafluoro-3,3-bis(2,2,2-trifluoroethoxy)pentane (PubChem CID 10072322) has the molecular formula C9H4F16O2 and a molecular weight of 448.10 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,5,5,5-decafluoro-3,3-bis(2,2,2-trifluoroethoxy)pentane.
| Compound Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3,3-bis(2,2,2-trifluoroethoxy)pentane |
|---|---|
| PubChem CID | 10072322 |
| Molecular Formula | C9H4F16O2 |
| Molecular Weight | 448.10 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3,3-bis(2,2,2-trifluoroethoxy)pentane |
| SMILES | FC(F)(F)COC(OCC(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F16O2/c10-3(11,12)1-26-7(27-2-4(13,14)15,5(16,17)8(20,21)22)6(18,19)9(23,24)25/h1-2H2 |
| InChIKey | ZFCVRCJEAPKKAX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.10 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|