C10H9F13O3 — CID 156627224
2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane (PubChem CID 156627224) has the molecular formula C10H9F13O3 and a molecular weight of 424.15 g/mol. Its IUPAC name is 2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane.
| Compound Name | 2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 156627224 |
| Molecular Formula | C10H9F13O3 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane |
| SMILES | CCOCC(F)(OC(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F13O3/c1-2-24-3-5(11,8(15,16)17)26-7(9(18,19)20,10(21,22)23)25-4-6(12,13)14/h2-4H2,1H3 |
| InChIKey | ZKJXZELGJCOINK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|