C11H21F3O4 — CID 103150210
1,1,1-triethoxy-3-(2,2,2-trifluoroethoxy)propane (PubChem CID 103150210) has the molecular formula C11H21F3O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1,1,1-triethoxy-3-(2,2,2-trifluoroethoxy)propane.
| Compound Name | 1,1,1-triethoxy-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 103150210 |
| Molecular Formula | C11H21F3O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,1,1-triethoxy-3-(2,2,2-trifluoroethoxy)propane |
| SMILES | CCOC(CCOCC(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C11H21F3O4/c1-4-16-11(17-5-2,18-6-3)7-8-15-9-10(12,13)14/h4-9H2,1-3H3 |
| InChIKey | HYOYBDGTDWUFEM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|