C8H14F3NOS — CID 65249067
2,2-dimethyl-4-(2,2,2-trifluoroethoxy)butanethioamide (PubChem CID 65249067) has the molecular formula C8H14F3NOS and a molecular weight of 229.27 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2,2,2-trifluoroethoxy)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(2,2,2-trifluoroethoxy)butanethioamide |
|---|---|
| PubChem CID | 65249067 |
| Molecular Formula | C8H14F3NOS |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2,2-dimethyl-4-(2,2,2-trifluoroethoxy)butanethioamide |
| SMILES | CC(C)(CCOCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C8H14F3NOS/c1-7(2,6(12)14)3-4-13-5-8(9,10)11/h3-5H2,1-2H3,(H2,12,14) |
| InChIKey | UCWDPSQZBXRZTE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|