C13H16F3NOS — CID 65247944
2,2-dimethyl-4-[3-(trifluoromethyl)phenoxy]butanethioamide (PubChem CID 65247944) has the molecular formula C13H16F3NOS and a molecular weight of 291.34 g/mol. Its IUPAC name is 2,2-dimethyl-4-[3-(trifluoromethyl)phenoxy]butanethioamide.
| Compound Name | 2,2-dimethyl-4-[3-(trifluoromethyl)phenoxy]butanethioamide |
|---|---|
| PubChem CID | 65247944 |
| Molecular Formula | C13H16F3NOS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2,2-dimethyl-4-[3-(trifluoromethyl)phenoxy]butanethioamide |
| SMILES | CC(C)(CCOc1cccc(C(F)(F)F)c1)C(N)=S |
| InChI | InChI=1S/C13H16F3NOS/c1-12(2,11(17)19)6-7-18-10-5-3-4-9(8-10)13(14,15)16/h3-5,8H,6-7H2,1-2H3,(H2,17,19) |
| InChIKey | WZXGDRBTCKWFAO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|