C12H15F3O — CID 18721654
1-(2,2-dimethylpropoxy)-3-(trifluoromethyl)benzene (PubChem CID 18721654) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(2,2-dimethylpropoxy)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2-dimethylpropoxy)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 18721654 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(2,2-dimethylpropoxy)-3-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O/c1-11(2,3)8-16-10-6-4-5-9(7-10)12(13,14)15/h4-7H,8H2,1-3H3 |
| InChIKey | UEBFTGGATPMIIK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |