C16H25NOS — CID 65247667
4-(4-tert-butylphenoxy)-2,2-dimethylbutanethioamide (PubChem CID 65247667) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(4-tert-butylphenoxy)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65247667 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCOc1ccc(C(C)(C)C)cc1)C(N)=S |
| InChI | InChI=1S/C16H25NOS/c1-15(2,3)12-6-8-13(9-7-12)18-11-10-16(4,5)14(17)19/h6-9H,10-11H2,1-5H3,(H2,17,19) |
| InChIKey | QMSQPYXYFOVKLU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|