C14H27NOS — CID 114341120
4-(4,4-dimethylcyclohexyl)oxy-2,2-dimethylbutanethioamide (PubChem CID 114341120) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)oxy-2,2-dimethylbutanethioamide.
| Compound Name | 4-(4,4-dimethylcyclohexyl)oxy-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 114341120 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)oxy-2,2-dimethylbutanethioamide |
| SMILES | CC1(C)CCC(OCCC(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C14H27NOS/c1-13(2)7-5-11(6-8-13)16-10-9-14(3,4)12(15)17/h11H,5-10H2,1-4H3,(H2,15,17) |
| InChIKey | AMXDKCPVEHWWDM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|