C13H26N2O — CID 65251287
4-cycloheptyloxy-2,2-dimethylbutanimidamide (PubChem CID 65251287) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-cycloheptyloxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-cycloheptyloxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65251287 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4-cycloheptyloxy-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCOC1CCCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2,12(14)15)9-10-16-11-7-5-3-4-6-8-11/h11H,3-10H2,1-2H3,(H3,14,15) |
| InChIKey | AVALSKDUXYCHIZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|