C13H26N2O — CID 63833468
N'-(2-cyclohexyloxyethyl)-2,2-dimethylpropanimidamide (PubChem CID 63833468) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N'-(2-cyclohexyloxyethyl)-2,2-dimethylpropanimidamide.
| Compound Name | N'-(2-cyclohexyloxyethyl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 63833468 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N'-(2-cyclohexyloxyethyl)-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(C)/C(N)=N/CCOC1CCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2,3)12(14)15-9-10-16-11-7-5-4-6-8-11/h11H,4-10H2,1-3H3,(H2,14,15) |
| InChIKey | DHVOJAVKSAQCDM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|