C15H31N3 — CID 65258758
5-[cyclohexyl(ethyl)amino]-2,2-dimethylpentanimidamide (PubChem CID 65258758) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 5-[cyclohexyl(ethyl)amino]-2,2-dimethylpentanimidamide.
| Compound Name | 5-[cyclohexyl(ethyl)amino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65258758 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 5-[cyclohexyl(ethyl)amino]-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(CC)C1CCCCC1 |
| InChI | InChI=1S/C15H31N3/c1-4-18(13-9-6-5-7-10-13)12-8-11-15(2,3)14(16)17/h13H,4-12H2,1-3H3,(H3,16,17) |
| InChIKey | ZJNLGNOPJZMUIE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|