C12H27N3 — CID 106711904
6-(diethylamino)-2,2-dimethylhexanimidamide (PubChem CID 106711904) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 6-(diethylamino)-2,2-dimethylhexanimidamide.
| Compound Name | 6-(diethylamino)-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711904 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 6-(diethylamino)-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCN(CC)CC |
| InChI | InChI=1S/C12H27N3/c1-5-15(6-2)10-8-7-9-12(3,4)11(13)14/h5-10H2,1-4H3,(H3,13,14) |
| InChIKey | UEBGLZPFVXTXKJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|