C14H32N4 — CID 102993810
5-[3-(dimethylamino)propyl-ethylamino]-2,2-dimethylpentanimidamide (PubChem CID 102993810) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl-ethylamino]-2,2-dimethylpentanimidamide.
| Compound Name | 5-[3-(dimethylamino)propyl-ethylamino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 102993810 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 5-[3-(dimethylamino)propyl-ethylamino]-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(CC)CCCN(C)C |
| InChI | InChI=1S/C14H32N4/c1-6-18(12-8-10-17(4)5)11-7-9-14(2,3)13(15)16/h6-12H2,1-5H3,(H3,15,16) |
| InChIKey | PKVYALKIDBGYQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|