C15H33N3O2 — CID 102996569
methyl 5-[3-(dimethylamino)propyl-ethylamino]-2-methyl-2-(methylamino)pentanoate (PubChem CID 102996569) has the molecular formula C15H33N3O2 and a molecular weight of 287.45 g/mol. Its IUPAC name is methyl 5-[3-(dimethylamino)propyl-ethylamino]-2-methyl-2-(methylamino)pentanoate.
| Compound Name | methyl 5-[3-(dimethylamino)propyl-ethylamino]-2-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 102996569 |
| Molecular Formula | C15H33N3O2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | methyl 5-[3-(dimethylamino)propyl-ethylamino]-2-methyl-2-(methylamino)pentanoate |
| SMILES | CCN(CCCN(C)C)CCCC(C)(NC)C(=O)OC |
| InChI | InChI=1S/C15H33N3O2/c1-7-18(13-9-11-17(4)5)12-8-10-15(2,16-3)14(19)20-6/h16H,7-13H2,1-6H3 |
| InChIKey | MHPSGEZPAPXPFP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |