C10H22N2O — CID 65252580
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanimidamide (PubChem CID 65252580) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanimidamide.
| Compound Name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanimidamide |
|---|---|
| PubChem CID | 65252580 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-9(2,3)13-7-6-10(4,5)8(11)12/h6-7H2,1-5H3,(H3,11,12) |
| InChIKey | PLYXZAFVCHNFKC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|