C4H6F6O2Si — CID 154503905
bis(2,2,2-trifluoroethoxy)silane (PubChem CID 154503905) has the molecular formula C4H6F6O2Si and a molecular weight of 228.16 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethoxy)silane.
| Compound Name | bis(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 154503905 |
| Molecular Formula | C4H6F6O2Si |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | bis(2,2,2-trifluoroethoxy)silane |
| SMILES | FC(F)(F)CO[SiH2]OCC(F)(F)F |
| InChI | InChI=1S/C4H6F6O2Si/c5-3(6,7)1-11-13-12-2-4(8,9)10/h1-2,13H2 |
| InChIKey | RKHYXYNGEXMECI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|