C9H15F9O3Si2 — CID 139696293
dimethyl-[methyl-bis(2,2,2-trifluoroethoxy)silyl]-(2,2,2-trifluoroethoxy)silane (PubChem CID 139696293) has the molecular formula C9H15F9O3Si2 and a molecular weight of 398.37 g/mol. Its IUPAC name is dimethyl-[methyl-bis(2,2,2-trifluoroethoxy)silyl]-(2,2,2-trifluoroethoxy)silane.
| Compound Name | dimethyl-[methyl-bis(2,2,2-trifluoroethoxy)silyl]-(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 139696293 |
| Molecular Formula | C9H15F9O3Si2 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | dimethyl-[methyl-bis(2,2,2-trifluoroethoxy)silyl]-(2,2,2-trifluoroethoxy)silane |
| SMILES | C[Si](C)(OCC(F)(F)F)[Si](C)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H15F9O3Si2/c1-22(2,19-4-7(10,11)12)23(3,20-5-8(13,14)15)21-6-9(16,17)18/h4-6H2,1-3H3 |
| InChIKey | SXGWGDFBOWGYFA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|