C7H9F9O3Si — CID 19017914
methyl-tris(2,2,2-trifluoroethoxy)silane (PubChem CID 19017914) has the molecular formula C7H9F9O3Si and a molecular weight of 340.21 g/mol. Its IUPAC name is methyl-tris(2,2,2-trifluoroethoxy)silane.
| Compound Name | methyl-tris(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 19017914 |
| Molecular Formula | C7H9F9O3Si |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | methyl-tris(2,2,2-trifluoroethoxy)silane |
| SMILES | C[Si](OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C7H9F9O3Si/c1-20(17-2-5(8,9)10,18-3-6(11,12)13)19-4-7(14,15)16/h2-4H2,1H3 |
| InChIKey | WFIGRLRSZIPCQR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|