C10H13F11O4 — CID 88850835
1,1,2,2-tetrafluoro-1-(2-fluoroethoxymethoxy)ethane;1,1,1-trifluoro-2-(2,2,2-trifluoroethoxymethoxy)ethane (PubChem CID 88850835) has the molecular formula C10H13F11O4 and a molecular weight of 406.19 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-(2-fluoroethoxymethoxy)ethane;1,1,1-trifluoro-2-(2,2,2-trifluoroethoxymethoxy)ethane.
| Compound Name | 1,1,2,2-tetrafluoro-1-(2-fluoroethoxymethoxy)ethane;1,1,1-trifluoro-2-(2,2,2-trifluoroethoxymethoxy)ethane |
|---|---|
| PubChem CID | 88850835 |
| Molecular Formula | C10H13F11O4 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-(2-fluoroethoxymethoxy)ethane;1,1,1-trifluoro-2-(2,2,2-trifluoroethoxymethoxy)ethane |
| SMILES | FC(F)(F)COCOCC(F)(F)F.FCCOCOC(F)(F)C(F)F |
| InChI | InChI=1S/C5H6F6O2.C5H7F5O2/c6-4(7,8)1-12-3-13-2-5(9,10)11;6-1-2-11-3-12-5(9,10)4(7)8/h1-3H2;4H,1-3H2 |
| InChIKey | PIBSPZKFLBDKGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|