C11H4F18O3 — CID 166762546
1,1,2,3,3-pentafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(1,1,2,2-tetrafluoroethoxy)-3-(1,1,2,2-tetrafluoropropoxy)propane (PubChem CID 166762546) has the molecular formula C11H4F18O3 and a molecular weight of 526.11 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(1,1,2,2-tetrafluoroethoxy)-3-(1,1,2,2-tetrafluoropropoxy)propane.
| Compound Name | 1,1,2,3,3-pentafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(1,1,2,2-tetrafluoroethoxy)-3-(1,1,2,2-tetrafluoropropoxy)propane |
|---|---|
| PubChem CID | 166762546 |
| Molecular Formula | C11H4F18O3 |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(1,1,2,2-tetrafluoroethoxy)-3-(1,1,2,2-tetrafluoropropoxy)propane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)F)C(F)(F)OC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C11H4F18O3/c1-5(17,18)9(24,25)32-11(28,29)8(23,30-7(21,22)4(15)16)10(26,27)31-6(19,20)2(12)3(13)14/h4H,1H3 |
| InChIKey | FTPFPECMYJQWAY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|