C5H2F8O2 — CID 175944751
3-[difluoro(trifluoromethoxy)methoxy]-2,3,3-trifluoroprop-1-ene (PubChem CID 175944751) has the molecular formula C5H2F8O2 and a molecular weight of 246.05 g/mol. Its IUPAC name is 3-[difluoro(trifluoromethoxy)methoxy]-2,3,3-trifluoroprop-1-ene.
| Compound Name | 3-[difluoro(trifluoromethoxy)methoxy]-2,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 175944751 |
| Molecular Formula | C5H2F8O2 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 3-[difluoro(trifluoromethoxy)methoxy]-2,3,3-trifluoroprop-1-ene |
| SMILES | C=C(F)C(F)(F)OC(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C5H2F8O2/c1-2(6)3(7,8)14-5(12,13)15-4(9,10)11/h1H2 |
| InChIKey | BQJZUYFVBTWGQP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|