C12H11F13O5 — CID 59364918
3-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propane-1,2-diol (PubChem CID 59364918) has the molecular formula C12H11F13O5 and a molecular weight of 482.19 g/mol. Its IUPAC name is 3-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propane-1,2-diol.
| Compound Name | 3-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59364918 |
| Molecular Formula | C12H11F13O5 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 3-[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propane-1,2-diol |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(COCC(O)CO)C(F)(F)F |
| InChI | InChI=1S/C12H11F13O5/c1-5(13)8(15,16)30-9(17,11(21,22)23)12(24,25)29-7(14,10(18,19)20)4-28-3-6(27)2-26/h6,26-27H,1-4H2 |
| InChIKey | OAOYQOBEDZSUHV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |