C12H5F19O4 — CID 59628110
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propan-1-ol (PubChem CID 59628110) has the molecular formula C12H5F19O4 and a molecular weight of 574.13 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propan-1-ol.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propan-1-ol |
|---|---|
| PubChem CID | 59628110 |
| Molecular Formula | C12H5F19O4 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]propan-1-ol |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(CO)C(F)(F)F |
| InChI | InChI=1S/C12H5F19O4/c1-3(13)5(15,16)34-6(17,9(22,23)24)12(30,31)35-7(18,10(25,26)27)11(28,29)33-4(14,2-32)8(19,20)21/h32H,1-2H2 |
| InChIKey | ZGALKVAKFQMHDQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |