C8H4F12O2 — CID 91321299
1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)-3-(1,1,2-trifluoroprop-2-enoxy)butan-2-ol (PubChem CID 91321299) has the molecular formula C8H4F12O2 and a molecular weight of 360.09 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)-3-(1,1,2-trifluoroprop-2-enoxy)butan-2-ol.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)-3-(1,1,2-trifluoroprop-2-enoxy)butan-2-ol |
|---|---|
| PubChem CID | 91321299 |
| Molecular Formula | C8H4F12O2 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)-3-(1,1,2-trifluoroprop-2-enoxy)butan-2-ol |
| SMILES | C=C(F)C(F)(F)OC(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O2/c1-2(9)6(13,14)22-3(5(10,11)12)4(21,7(15,16)17)8(18,19)20/h3,21H,1H2 |
| InChIKey | OPNBYQJKRMNVKI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |