C10H9F13O3 — CID 90845834
4,4,4-trifluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]butan-2-ol;hydrofluoride (PubChem CID 90845834) has the molecular formula C10H9F13O3 and a molecular weight of 424.15 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]butan-2-ol;hydrofluoride.
| Compound Name | 4,4,4-trifluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]butan-2-ol;hydrofluoride |
|---|---|
| PubChem CID | 90845834 |
| Molecular Formula | C10H9F13O3 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 4,4,4-trifluoro-3-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]butan-2-ol;hydrofluoride |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(C(C)O)C(F)(F)F.F |
| InChI | InChI=1S/C10H8F12O3.FH/c1-3(23)5(6(12,13)14)24-10(21,22)8(17,9(18,19)20)25-7(15,16)4(2)11;/h3,5,23H,2H2,1H3;1H |
| InChIKey | JSMLVYUWYOIEBM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |