C10H12F10O2 — CID 91111847
2-fluoropropan-2-ol;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane (PubChem CID 91111847) has the molecular formula C10H12F10O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is 2-fluoropropan-2-ol;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane.
| Compound Name | 2-fluoropropan-2-ol;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
|---|---|
| PubChem CID | 91111847 |
| Molecular Formula | C10H12F10O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-fluoropropan-2-ol;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
| SMILES | C=C(F)C(F)(F)OC(CC(F)(F)F)C(F)(F)F.CC(C)(O)F |
| InChI | InChI=1S/C7H5F9O.C3H7FO/c1-3(8)7(15,16)17-4(6(12,13)14)2-5(9,10)11;1-3(2,4)5/h4H,1-2H2;5H,1-2H3 |
| InChIKey | BLZUNMXJPJFEGJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |