C9H8F10O — CID 91144902
fluoroethene;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane (PubChem CID 91144902) has the molecular formula C9H8F10O and a molecular weight of 322.14 g/mol. Its IUPAC name is fluoroethene;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane.
| Compound Name | fluoroethene;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
|---|---|
| PubChem CID | 91144902 |
| Molecular Formula | C9H8F10O |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | fluoroethene;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
| SMILES | C=C(F)C(F)(F)OC(CC(F)(F)F)C(F)(F)F.C=CF |
| InChI | InChI=1S/C7H5F9O.C2H3F/c1-3(8)7(15,16)17-4(6(12,13)14)2-5(9,10)11;1-2-3/h4H,1-2H2;2H,1H2 |
| InChIKey | SNHVOMYWMQUOLZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |